C16H20 — CID 86143848
1,2,3,3a,4,5,6,6a,6b,7-decahydrofluoranthene (PubChem CID 86143848) has the molecular formula C16H20 and a molecular weight of 212.34 g/mol. Its IUPAC name is 1,2,3,3a,4,5,6,6a,6b,7-decahydrofluoranthene.
| Compound Name | 1,2,3,3a,4,5,6,6a,6b,7-decahydrofluoranthene |
|---|---|
| PubChem CID | 86143848 |
| Molecular Formula | C16H20 |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | 1,2,3,3a,4,5,6,6a,6b,7-decahydrofluoranthene |
| SMILES | C1=CCC2C(=C1)C1=C3C(CCC1)CCCC32 |
| InChI | InChI=1S/C16H20/c1-2-8-13-12(7-1)14-9-3-5-11-6-4-10-15(13)16(11)14/h1-2,7,11,13,15H,3-6,8-10H2 |
| InChIKey | DQXHJOFURLIDNJ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |