C9H12N- — CID 19835384
2-methyl-2,3,3a,4-tetrahydroindol-1-ide (PubChem CID 19835384) has the molecular formula C9H12N- and a molecular weight of 134.20 g/mol. Its IUPAC name is 2-methyl-2,3,3a,4-tetrahydroindol-1-ide.
| Compound Name | 2-methyl-2,3,3a,4-tetrahydroindol-1-ide |
|---|---|
| PubChem CID | 19835384 |
| Molecular Formula | C9H12N- |
| Molecular Weight | 134.20 g/mol |
| Exact Mass | 134.10 |
| IUPAC Name | 2-methyl-2,3,3a,4-tetrahydroindol-1-ide |
| SMILES | CC1CC2CC=CC=C2[N-]1 |
| InChI | InChI=1S/C9H12N/c1-7-6-8-4-2-3-5-9(8)10-7/h2-3,5,7-8H,4,6H2,1H3/q-1 |
| InChIKey | IZJOCNLQCNVEGW-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.20 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |