C20H26Zr — CID 154115178
bis(3-methyl-1,2,7,7a-tetrahydroinden-3-ide);zirconium(2+) (PubChem CID 154115178) has the molecular formula C20H26Zr and a molecular weight of 357.65 g/mol. Its IUPAC name is bis(3-methyl-1,2,7,7a-tetrahydroinden-3-ide);zirconium(2+).
| Compound Name | bis(3-methyl-1,2,7,7a-tetrahydroinden-3-ide);zirconium(2+) |
|---|---|
| PubChem CID | 154115178 |
| Molecular Formula | C20H26Zr |
| Molecular Weight | 357.65 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | bis(3-methyl-1,2,7,7a-tetrahydroinden-3-ide);zirconium(2+) |
| SMILES | C[C-]1CCC2CC=CC=C12.C[C-]1CCC2CC=CC=C12.[Zr+2] |
| InChI | InChI=1S/2C10H13.Zr/c2*1-8-6-7-9-4-2-3-5-10(8)9;/h2*2-3,5,9H,4,6-7H2,1H3;/q2*-1;+2 |
| InChIKey | VGRCISQRTLNUOT-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.65 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|