C19H26Ti — CID 151210146
2,3,3a,4-tetrahydro-1H-inden-1-ide;1,2,3,4,5-pentamethylcyclopenta-1,3-diene;titanium(2+) (PubChem CID 151210146) has the molecular formula C19H26Ti and a molecular weight of 302.28 g/mol. Its IUPAC name is 2,3,3a,4-tetrahydro-1H-inden-1-ide;1,2,3,4,5-pentamethylcyclopenta-1,3-diene;titanium(2+).
| Compound Name | 2,3,3a,4-tetrahydro-1H-inden-1-ide;1,2,3,4,5-pentamethylcyclopenta-1,3-diene;titanium(2+) |
|---|---|
| PubChem CID | 151210146 |
| Molecular Formula | C19H26Ti |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 2,3,3a,4-tetrahydro-1H-inden-1-ide;1,2,3,4,5-pentamethylcyclopenta-1,3-diene;titanium(2+) |
| SMILES | C1=CCC2CC[CH-]C2=C1.Cc1c(C)c(C)[c-](C)c1C.[Ti+2] |
| InChI | InChI=1S/C10H15.C9H11.Ti/c1-6-7(2)9(4)10(5)8(6)3;1-2-5-9-7-3-6-8(9)4-1;/h1-5H3;1-2,4,6,9H,3,5,7H2;/q2*-1;+2 |
| InChIKey | NKCIEZAWNVEDLL-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|