C34H36Zr — CID 174403588
bis(2,3,3a,4-tetrahydro-1H-inden-1-ide);4-phenylbuta-1,3-dienylbenzene;zirconium(2+) (PubChem CID 174403588) has the molecular formula C34H36Zr and a molecular weight of 535.89 g/mol. Its IUPAC name is bis(2,3,3a,4-tetrahydro-1H-inden-1-ide);4-phenylbuta-1,3-dienylbenzene;zirconium(2+).
| Compound Name | bis(2,3,3a,4-tetrahydro-1H-inden-1-ide);4-phenylbuta-1,3-dienylbenzene;zirconium(2+) |
|---|---|
| PubChem CID | 174403588 |
| Molecular Formula | C34H36Zr |
| Molecular Weight | 535.89 g/mol |
| Exact Mass | 534.19 |
| IUPAC Name | bis(2,3,3a,4-tetrahydro-1H-inden-1-ide);4-phenylbuta-1,3-dienylbenzene;zirconium(2+) |
| SMILES | C(C=Cc1ccccc1)=Cc1ccccc1.C1=CCC2CC[CH-]C2=C1.C1=CCC2CC[CH-]C2=C1.[Zr+2] |
| InChI | InChI=1S/C16H14.2C9H11.Zr/c1-3-9-15(10-4-1)13-7-8-14-16-11-5-2-6-12-16;2*1-2-5-9-7-3-6-8(9)4-1;/h1-14H;2*1-2,4,6,9H,3,5,7H2;/q;2*-1;+2 |
| InChIKey | ZQQFYWHVZRXDIQ-UHFFFAOYSA-N |
| XLogP | 9.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.89 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|