C21H26Cl2Ti — CID 151071578
bis(2,3,3a,4-tetrahydro-1H-inden-1-ide);1,1-dichloropropan-2-ylidenetitanium(2+) (PubChem CID 151071578) has the molecular formula C21H26Cl2Ti and a molecular weight of 397.21 g/mol. Its IUPAC name is bis(2,3,3a,4-tetrahydro-1H-inden-1-ide);1,1-dichloropropan-2-ylidenetitanium(2+).
| Compound Name | bis(2,3,3a,4-tetrahydro-1H-inden-1-ide);1,1-dichloropropan-2-ylidenetitanium(2+) |
|---|---|
| PubChem CID | 151071578 |
| Molecular Formula | C21H26Cl2Ti |
| Molecular Weight | 397.21 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | bis(2,3,3a,4-tetrahydro-1H-inden-1-ide);1,1-dichloropropan-2-ylidenetitanium(2+) |
| SMILES | C1=CCC2CC[CH-]C2=C1.C1=CCC2CC[CH-]C2=C1.CC(=[Ti+2])C(Cl)Cl |
| InChI | InChI=1S/2C9H11.C3H4Cl2.Ti/c2*1-2-5-9-7-3-6-8(9)4-1;1-2-3(4)5;/h2*1-2,4,6,9H,3,5,7H2;3H,1H3;/q2*-1;;+2 |
| InChIKey | RJDYCFLGBIMVSJ-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.21 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|