C9H11Cl2Zn- — CID 172750129
zinc;2,3,3a,4-tetrahydro-1H-inden-1-ide;dichloride (PubChem CID 172750129) has the molecular formula C9H11Cl2Zn- and a molecular weight of 255.48 g/mol. Its IUPAC name is zinc;2,3,3a,4-tetrahydro-1H-inden-1-ide;dichloride.
| Compound Name | zinc;2,3,3a,4-tetrahydro-1H-inden-1-ide;dichloride |
|---|---|
| PubChem CID | 172750129 |
| Molecular Formula | C9H11Cl2Zn- |
| Molecular Weight | 255.48 g/mol |
| Exact Mass | 252.95 |
| IUPAC Name | zinc;2,3,3a,4-tetrahydro-1H-inden-1-ide;dichloride |
| SMILES | C1=CCC2CC[CH-]C2=C1.[Cl-].[Cl-].[Zn+2] |
| InChI | InChI=1S/C9H11.2ClH.Zn/c1-2-5-9-7-3-6-8(9)4-1;;;/h1-2,4,6,9H,3,5,7H2;2*1H;/q-1;;;+2/p-2 |
| InChIKey | GGYTUNRJECOTAI-UHFFFAOYSA-L |
| XLogP | -3.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.48 |
| LogP ≤ 5 | -3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|