C18H18 — CID 174873535
1,2,3,6,6a,7-hexahydrochrysene (PubChem CID 174873535) has the molecular formula C18H18 and a molecular weight of 234.34 g/mol. Its IUPAC name is 1,2,3,6,6a,7-hexahydrochrysene.
| Compound Name | 1,2,3,6,6a,7-hexahydrochrysene |
|---|---|
| PubChem CID | 174873535 |
| Molecular Formula | C18H18 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 1,2,3,6,6a,7-hexahydrochrysene |
| SMILES | C1=CCC2CC=c3c(ccc4c3=CCCC4)C2=C1 |
| InChI | InChI=1S/C18H18/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18/h1,3,7-8,10-13H,2,4-6,9H2 |
| InChIKey | LIVQCBBJNYNNRU-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |