C16H18N2 — CID 174827013
2,3,3a,4-tetrahydro-1H-indole;1H-indole (PubChem CID 174827013) has the molecular formula C16H18N2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 2,3,3a,4-tetrahydro-1H-indole;1H-indole.
| Compound Name | 2,3,3a,4-tetrahydro-1H-indole;1H-indole |
|---|---|
| PubChem CID | 174827013 |
| Molecular Formula | C16H18N2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 2,3,3a,4-tetrahydro-1H-indole;1H-indole |
| SMILES | C1=CCC2CCNC2=C1.c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C8H11N.C8H7N/c2*1-2-4-8-7(3-1)5-6-9-8/h1-2,4,7,9H,3,5-6H2;1-6,9H |
| InChIKey | MYDRFHMHXKIKRW-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |