C22H27N — CID 174779227
1H-indole;pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane (PubChem CID 174779227) has the molecular formula C22H27N and a molecular weight of 305.46 g/mol. Its IUPAC name is 1H-indole;pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane.
| Compound Name | 1H-indole;pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane |
|---|---|
| PubChem CID | 174779227 |
| Molecular Formula | C22H27N |
| Molecular Weight | 305.46 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | 1H-indole;pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane |
| SMILES | C1C2CC3C4CC5CC(C14)C(C2)C3C5.c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C14H20.C8H7N/c1-7-2-12-10-4-8-5-11(9(1)10)13(3-7)14(12)6-8;1-2-4-8-7(3-1)5-6-9-8/h7-14H,1-6H2;1-6,9H |
| InChIKey | LPTIYGHRZHZYGV-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.46 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |