About 1H-indole;triazine
1H-indole;triazine (PubChem CID 90303592) has the molecular formula C11H10N4
and a molecular weight of 198.23 g/mol. Its IUPAC name is 1H-indole;triazine.
Molecular Properties
| Compound Name | 1H-indole;triazine |
| PubChem CID | 90303592 |
| Molecular Formula | C11H10N4 |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 1H-indole;triazine |
| SMILES | c1ccc2[nH]ccc2c1.c1cnnnc1 |
| InChI | InChI=1S/C8H7N.C3H3N3/c1-2-4-8-7(3-1)5-6-9-8;1-2-4-6-5-3-1/h1-6,9H;1-3H |
| InChIKey | FXVNLVNTOLJKBS-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1H-indole;triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indole;triazine?
The IUPAC name of 1H-indole;triazine (CID 90303592) is 1H-indole;triazine.
What is the SMILES notation for 1H-indole;triazine?
The canonical SMILES for 1H-indole;triazine is c1ccc2[nH]ccc2c1.c1cnnnc1.
What is the InChIKey of 1H-indole;triazine?
The InChIKey is FXVNLVNTOLJKBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N.C3H3N3/c1-2-4-8-7(3-1)5-6-9-8;1-2-4-6-5-3-1/h1-6,9H;1-3H.
What are the key properties of 1H-indole;triazine?
1H-indole;triazine has a molecular weight of 198.23 g/mol, XLogP of 2.04, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indole;triazine is sourced from PubChem (CID 90303592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).