C11H16O — CID 178055178
4-cyclohexa-1,3-dien-1-yl-2,2-dimethyloxetane (PubChem CID 178055178) has the molecular formula C11H16O and a molecular weight of 164.25 g/mol. Its IUPAC name is 4-cyclohexa-1,3-dien-1-yl-2,2-dimethyloxetane.
| Compound Name | 4-cyclohexa-1,3-dien-1-yl-2,2-dimethyloxetane |
|---|---|
| PubChem CID | 178055178 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | 4-cyclohexa-1,3-dien-1-yl-2,2-dimethyloxetane |
| SMILES | CC1(C)CC(C2=CC=CCC2)O1 |
| InChI | InChI=1S/C11H16O/c1-11(2)8-10(12-11)9-6-4-3-5-7-9/h3-4,6,10H,5,7-8H2,1-2H3 |
| InChIKey | OKKGKCBTOOWKRL-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |