C13H21N — CID 139470360
3-cyclohexa-1,3-dien-1-yl-1-methylcyclohexan-1-amine (PubChem CID 139470360) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is 3-cyclohexa-1,3-dien-1-yl-1-methylcyclohexan-1-amine.
| Compound Name | 3-cyclohexa-1,3-dien-1-yl-1-methylcyclohexan-1-amine |
|---|---|
| PubChem CID | 139470360 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | 3-cyclohexa-1,3-dien-1-yl-1-methylcyclohexan-1-amine |
| SMILES | CC1(N)CCCC(C2=CC=CCC2)C1 |
| InChI | InChI=1S/C13H21N/c1-13(14)9-5-8-12(10-13)11-6-3-2-4-7-11/h2-3,6,12H,4-5,7-10,14H2,1H3 |
| InChIKey | IOJKBOZXKGOICF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |