C12H16 — CID 163288981
1-cyclopenta-2,4-dien-1-ylcycloheptene (PubChem CID 163288981) has the molecular formula C12H16 and a molecular weight of 160.26 g/mol. Its IUPAC name is 1-cyclopenta-2,4-dien-1-ylcycloheptene.
| Compound Name | 1-cyclopenta-2,4-dien-1-ylcycloheptene |
|---|---|
| PubChem CID | 163288981 |
| Molecular Formula | C12H16 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | 1-cyclopenta-2,4-dien-1-ylcycloheptene |
| SMILES | C1=CC(C2=CCCCCC2)C=C1 |
| InChI | InChI=1S/C12H16/c1-2-4-8-11(7-3-1)12-9-5-6-10-12/h5-7,9-10,12H,1-4,8H2 |
| InChIKey | UTSPLGIDLUICPE-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|