C10H16O — CID 12692992
trans-(1S,2R)-2-(cyclohexen-1-yl)cyclobutan-1-ol (PubChem CID 12692992) has the molecular formula C10H16O and a molecular weight of 152.24 g/mol. Its IUPAC name is trans-(1S,2R)-2-(cyclohexen-1-yl)cyclobutan-1-ol.
| Compound Name | trans-(1S,2R)-2-(cyclohexen-1-yl)cyclobutan-1-ol |
|---|---|
| PubChem CID | 12692992 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | trans-(1S,2R)-2-(cyclohexen-1-yl)cyclobutan-1-ol |
| SMILES | O[C@H]1CC[C@@H]1C1=CCCCC1 |
| InChI | InChI=1S/C10H16O/c11-10-7-6-9(10)8-4-2-1-3-5-8/h4,9-11H,1-3,5-7H2/t9-,10+/m1/s1 |
| InChIKey | VSBABVYAVPWQSM-ZJUUUORDSA-N |
| XLogP | 2.26 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|