C24H38O — CID 166972270
cis-(1R,2R)-2-[5-[(3S)-3-(cyclohexen-1-yl)cyclohexyl]cyclohexen-1-yl]cyclohexan-1-ol (PubChem CID 166972270) has the molecular formula C24H38O and a molecular weight of 342.57 g/mol. Its IUPAC name is cis-(1R,2R)-2-[5-[(3S)-3-(cyclohexen-1-yl)cyclohexyl]cyclohexen-1-yl]cyclohexan-1-ol.
| Compound Name | cis-(1R,2R)-2-[5-[(3S)-3-(cyclohexen-1-yl)cyclohexyl]cyclohexen-1-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 166972270 |
| Molecular Formula | C24H38O |
| Molecular Weight | 342.57 g/mol |
| Exact Mass | 342.29 |
| IUPAC Name | cis-(1R,2R)-2-[5-[(3S)-3-(cyclohexen-1-yl)cyclohexyl]cyclohexen-1-yl]cyclohexan-1-ol |
| SMILES | O[C@@H]1CCCC[C@@H]1C1=CCCC(C2CCC[C@H](C3=CCCCC3)C2)C1 |
| InChI | InChI=1S/C24H38O/c25-24-15-5-4-14-23(24)22-13-7-12-21(17-22)20-11-6-10-19(16-20)18-8-2-1-3-9-18/h8,13,19-21,23-25H,1-7,9-12,14-17H2/t19-,20?,21?,23+,24+/m0/s1 |
| InChIKey | JSWVFLMUGQUQKE-VKDALRDQSA-N |
| XLogP | 6.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.57 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|