C13H16 — CID 151916060
2-cyclopenta-2,4-dien-1-ylcycloocta-1,3-diene (PubChem CID 151916060) has the molecular formula C13H16 and a molecular weight of 172.27 g/mol. Its IUPAC name is 2-cyclopenta-2,4-dien-1-ylcycloocta-1,3-diene.
| Compound Name | 2-cyclopenta-2,4-dien-1-ylcycloocta-1,3-diene |
|---|---|
| PubChem CID | 151916060 |
| Molecular Formula | C13H16 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | 2-cyclopenta-2,4-dien-1-ylcycloocta-1,3-diene |
| SMILES | C1=CC(C2=CCCCCC=C2)C=C1 |
| InChI | InChI=1S/C13H16/c1-2-4-8-12(9-5-3-1)13-10-6-7-11-13/h4,6-11,13H,1-3,5H2 |
| InChIKey | XZCLBKZDFLQDIN-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |