C22H30 — CID 162298979
2,12-dimethylcycloicosa-1,3,5,8,10,13,15-heptaene (PubChem CID 162298979) has the molecular formula C22H30 and a molecular weight of 294.48 g/mol. Its IUPAC name is 2,12-dimethylcycloicosa-1,3,5,8,10,13,15-heptaene.
| Compound Name | 2,12-dimethylcycloicosa-1,3,5,8,10,13,15-heptaene |
|---|---|
| PubChem CID | 162298979 |
| Molecular Formula | C22H30 |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.23 |
| IUPAC Name | 2,12-dimethylcycloicosa-1,3,5,8,10,13,15-heptaene |
| SMILES | CC1=CCCCCC=CC=CC(C)C=CC=CCC=CC=C1 |
| InChI | InChI=1S/C22H30/c1-21-17-13-9-5-3-7-11-15-19-22(2)20-16-12-8-4-6-10-14-18-21/h5-7,9-11,13-15,17-21H,3-4,8,12,16H2,1-2H3 |
| InChIKey | AGKVDUIDHZLTSS-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |