C16H28N2O — CID 163215558
7-cyclohexyl-7,9-diazaspiro[5.6]dodecan-8-one (PubChem CID 163215558) has the molecular formula C16H28N2O and a molecular weight of 264.41 g/mol. Its IUPAC name is 7-cyclohexyl-7,9-diazaspiro[5.6]dodecan-8-one.
| Compound Name | 7-cyclohexyl-7,9-diazaspiro[5.6]dodecan-8-one |
|---|---|
| PubChem CID | 163215558 |
| Molecular Formula | C16H28N2O |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.22 |
| IUPAC Name | 7-cyclohexyl-7,9-diazaspiro[5.6]dodecan-8-one |
| SMILES | O=C1NCCCC2(CCCCC2)N1C1CCCCC1 |
| InChI | InChI=1S/C16H28N2O/c19-15-17-13-7-12-16(10-5-2-6-11-16)18(15)14-8-3-1-4-9-14/h14H,1-13H2,(H,17,19) |
| InChIKey | CRHVDTFNVAGFTJ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |