C14H22N2O2 — CID 113309795
4-cyclopentyl-2,4-diazaspiro[5.5]undecane-3,5-dione (PubChem CID 113309795) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 4-cyclopentyl-2,4-diazaspiro[5.5]undecane-3,5-dione.
| Compound Name | 4-cyclopentyl-2,4-diazaspiro[5.5]undecane-3,5-dione |
|---|---|
| PubChem CID | 113309795 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 4-cyclopentyl-2,4-diazaspiro[5.5]undecane-3,5-dione |
| SMILES | O=C1NCC2(CCCCC2)C(=O)N1C1CCCC1 |
| InChI | InChI=1S/C14H22N2O2/c17-12-14(8-4-1-5-9-14)10-15-13(18)16(12)11-6-2-3-7-11/h11H,1-10H2,(H,15,18) |
| InChIKey | FKQAGOVOSMZDDA-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |