C14H16N2O2 — CID 115434500
9-phenyl-7,9-diazaspiro[4.5]decane-8,10-dione (PubChem CID 115434500) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is 9-phenyl-7,9-diazaspiro[4.5]decane-8,10-dione.
| Compound Name | 9-phenyl-7,9-diazaspiro[4.5]decane-8,10-dione |
|---|---|
| PubChem CID | 115434500 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 9-phenyl-7,9-diazaspiro[4.5]decane-8,10-dione |
| SMILES | O=C1NCC2(CCCC2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C14H16N2O2/c17-12-14(8-4-5-9-14)10-15-13(18)16(12)11-6-2-1-3-7-11/h1-3,6-7H,4-5,8-10H2,(H,15,18) |
| InChIKey | LABNKWPVBZIGNO-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |