C13H13FN2O2 — CID 113311484
8-(4-fluorophenyl)-6,8-diazaspiro[3.5]nonane-7,9-dione (PubChem CID 113311484) has the molecular formula C13H13FN2O2 and a molecular weight of 248.26 g/mol. Its IUPAC name is 8-(4-fluorophenyl)-6,8-diazaspiro[3.5]nonane-7,9-dione.
| Compound Name | 8-(4-fluorophenyl)-6,8-diazaspiro[3.5]nonane-7,9-dione |
|---|---|
| PubChem CID | 113311484 |
| Molecular Formula | C13H13FN2O2 |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 8-(4-fluorophenyl)-6,8-diazaspiro[3.5]nonane-7,9-dione |
| SMILES | O=C1NCC2(CCC2)C(=O)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C13H13FN2O2/c14-9-2-4-10(5-3-9)16-11(17)13(6-1-7-13)8-15-12(16)18/h2-5H,1,6-8H2,(H,15,18) |
| InChIKey | BFVBGVLMIKCWSC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |