C13H20N2O2 — CID 81167524
8-cyclopentyl-6,8-diazaspiro[3.6]decane-7,9-dione (PubChem CID 81167524) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is 8-cyclopentyl-6,8-diazaspiro[3.6]decane-7,9-dione.
| Compound Name | 8-cyclopentyl-6,8-diazaspiro[3.6]decane-7,9-dione |
|---|---|
| PubChem CID | 81167524 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 8-cyclopentyl-6,8-diazaspiro[3.6]decane-7,9-dione |
| SMILES | O=C1CC2(CCC2)CNC(=O)N1C1CCCC1 |
| InChI | InChI=1S/C13H20N2O2/c16-11-8-13(6-3-7-13)9-14-12(17)15(11)10-4-1-2-5-10/h10H,1-9H2,(H,14,17) |
| InChIKey | RPOVAIQGULWBHE-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |