C14H22N2O3 — CID 115444841
4-(oxolan-3-yl)-2,4-diazaspiro[5.6]dodecane-3,5-dione (PubChem CID 115444841) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is 4-(oxolan-3-yl)-2,4-diazaspiro[5.6]dodecane-3,5-dione.
| Compound Name | 4-(oxolan-3-yl)-2,4-diazaspiro[5.6]dodecane-3,5-dione |
|---|---|
| PubChem CID | 115444841 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 4-(oxolan-3-yl)-2,4-diazaspiro[5.6]dodecane-3,5-dione |
| SMILES | O=C1NCC2(CCCCCC2)C(=O)N1C1CCOC1 |
| InChI | InChI=1S/C14H22N2O3/c17-12-14(6-3-1-2-4-7-14)10-15-13(18)16(12)11-5-8-19-9-11/h11H,1-10H2,(H,15,18) |
| InChIKey | COKWQEUFVGIEDW-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |