C10H16N2O4 — CID 103160223
6-methoxy-3-(oxolan-3-yl)-1,3-diazepane-2,4-dione (PubChem CID 103160223) has the molecular formula C10H16N2O4 and a molecular weight of 228.25 g/mol. Its IUPAC name is 6-methoxy-3-(oxolan-3-yl)-1,3-diazepane-2,4-dione.
| Compound Name | 6-methoxy-3-(oxolan-3-yl)-1,3-diazepane-2,4-dione |
|---|---|
| PubChem CID | 103160223 |
| Molecular Formula | C10H16N2O4 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 6-methoxy-3-(oxolan-3-yl)-1,3-diazepane-2,4-dione |
| SMILES | COC1CNC(=O)N(C2CCOC2)C(=O)C1 |
| InChI | InChI=1S/C10H16N2O4/c1-15-8-4-9(13)12(10(14)11-5-8)7-2-3-16-6-7/h7-8H,2-6H2,1H3,(H,11,14) |
| InChIKey | XQESPHZOBHGDPG-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |