C17H22N2O2 — CID 131652109
(5S,9S)-7-(oxolan-3-yl)-9-phenyl-2,7-diazaspiro[4.4]nonan-1-one (PubChem CID 131652109) has the molecular formula C17H22N2O2 and a molecular weight of 286.37 g/mol. Its IUPAC name is (5S,9S)-7-(oxolan-3-yl)-9-phenyl-2,7-diazaspiro[4.4]nonan-1-one.
| Compound Name | (5S,9S)-7-(oxolan-3-yl)-9-phenyl-2,7-diazaspiro[4.4]nonan-1-one |
|---|---|
| PubChem CID | 131652109 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | (5S,9S)-7-(oxolan-3-yl)-9-phenyl-2,7-diazaspiro[4.4]nonan-1-one |
| SMILES | O=C1NCC[C@]12CN(C1CCOC1)C[C@H]2c1ccccc1 |
| InChI | InChI=1S/C17H22N2O2/c20-16-17(7-8-18-16)12-19(14-6-9-21-11-14)10-15(17)13-4-2-1-3-5-13/h1-5,14-15H,6-12H2,(H,18,20)/t14?,15-,17+/m0/s1 |
| InChIKey | QTUYVLIFLQQWCB-IGGKNEPZSA-N |
| XLogP | 1.38 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |