C17H23N3O2 — CID 124521986
(5R)-9-[(3R)-oxolan-3-yl]-2-pyridin-3-yl-2,9-diazaspiro[4.5]decan-1-one (PubChem CID 124521986) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is (5R)-9-[(3R)-oxolan-3-yl]-2-pyridin-3-yl-2,9-diazaspiro[4.5]decan-1-one.
| Compound Name | (5R)-9-[(3R)-oxolan-3-yl]-2-pyridin-3-yl-2,9-diazaspiro[4.5]decan-1-one |
|---|---|
| PubChem CID | 124521986 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | (5R)-9-[(3R)-oxolan-3-yl]-2-pyridin-3-yl-2,9-diazaspiro[4.5]decan-1-one |
| SMILES | O=C1N(c2cccnc2)CC[C@@]12CCCN([C@@H]1CCOC1)C2 |
| InChI | InChI=1S/C17H23N3O2/c21-16-17(6-9-20(16)14-3-1-7-18-11-14)5-2-8-19(13-17)15-4-10-22-12-15/h1,3,7,11,15H,2,4-6,8-10,12-13H2/t15-,17-/m1/s1 |
| InChIKey | FYQYYGIQQSHRHY-NVXWUHKLSA-N |
| XLogP | 1.69 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |