C18H21N3O2 — CID 97451472
(5R)-7-(cyclopent-3-ene-1-carbonyl)-2-pyridin-3-yl-2,7-diazaspiro[4.4]nonan-1-one (PubChem CID 97451472) has the molecular formula C18H21N3O2 and a molecular weight of 311.38 g/mol. Its IUPAC name is (5R)-7-(cyclopent-3-ene-1-carbonyl)-2-pyridin-3-yl-2,7-diazaspiro[4.4]nonan-1-one.
| Compound Name | (5R)-7-(cyclopent-3-ene-1-carbonyl)-2-pyridin-3-yl-2,7-diazaspiro[4.4]nonan-1-one |
|---|---|
| PubChem CID | 97451472 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | (5R)-7-(cyclopent-3-ene-1-carbonyl)-2-pyridin-3-yl-2,7-diazaspiro[4.4]nonan-1-one |
| SMILES | O=C(C1CC=CC1)N1CC[C@@]2(CCN(c3cccnc3)C2=O)C1 |
| InChI | InChI=1S/C18H21N3O2/c22-16(14-4-1-2-5-14)20-10-7-18(13-20)8-11-21(17(18)23)15-6-3-9-19-12-15/h1-3,6,9,12,14H,4-5,7-8,10-11,13H2/t18-/m1/s1 |
| InChIKey | MEXKNVBJGHWHSE-GOSISDBHSA-N |
| XLogP | 2.00 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|