C10H17NO2 — CID 10397469
(6S,11R)-11-hydroxy-2-azaspiro[5.5]undecan-1-one (PubChem CID 10397469) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is (6S,11R)-11-hydroxy-2-azaspiro[5.5]undecan-1-one.
| Compound Name | (6S,11R)-11-hydroxy-2-azaspiro[5.5]undecan-1-one |
|---|---|
| PubChem CID | 10397469 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | (6S,11R)-11-hydroxy-2-azaspiro[5.5]undecan-1-one |
| SMILES | O=C1NCCC[C@]12CCCC[C@H]2O |
| InChI | InChI=1S/C10H17NO2/c12-8-4-1-2-5-10(8)6-3-7-11-9(10)13/h8,12H,1-7H2,(H,11,13)/t8-,10+/m1/s1 |
| InChIKey | CEZMHNNWOLFNJU-SCZZXKLOSA-N |
| XLogP | 0.82 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |