C18H31N3O5 — CID 154920989
(6R,11S)-8-[2-[cyclopentyl(methyl)amino]acetyl]-11-hydroxy-2,8-diazaspiro[5.5]undecan-1-one;formic acid (PubChem CID 154920989) has the molecular formula C18H31N3O5 and a molecular weight of 369.46 g/mol. Its IUPAC name is (6R,11S)-8-[2-[cyclopentyl(methyl)amino]acetyl]-11-hydroxy-2,8-diazaspiro[5.5]undecan-1-one;formic acid.
| Compound Name | (6R,11S)-8-[2-[cyclopentyl(methyl)amino]acetyl]-11-hydroxy-2,8-diazaspiro[5.5]undecan-1-one;formic acid |
|---|---|
| PubChem CID | 154920989 |
| Molecular Formula | C18H31N3O5 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | (6R,11S)-8-[2-[cyclopentyl(methyl)amino]acetyl]-11-hydroxy-2,8-diazaspiro[5.5]undecan-1-one;formic acid |
| SMILES | CN(CC(=O)N1CC[C@H](O)[C@@]2(CCCNC2=O)C1)C1CCCC1.O=CO |
| InChI | InChI=1S/C17H29N3O3.CH2O2/c1-19(13-5-2-3-6-13)11-15(22)20-10-7-14(21)17(12-20)8-4-9-18-16(17)23;2-1-3/h13-14,21H,2-12H2,1H3,(H,18,23);1H,(H,2,3)/t14-,17+;/m0./s1 |
| InChIKey | MMJTUWBFEATWTB-SQQLFYIASA-N |
| XLogP | 0.05 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|