C16H25N5O5 — CID 166597986
formic acid;(6R,11S)-11-hydroxy-8-[4-(1,2,4-triazol-1-yl)butanoyl]-2,8-diazaspiro[5.5]undecan-1-one (PubChem CID 166597986) has the molecular formula C16H25N5O5 and a molecular weight of 367.41 g/mol. Its IUPAC name is formic acid;(6R,11S)-11-hydroxy-8-[4-(1,2,4-triazol-1-yl)butanoyl]-2,8-diazaspiro[5.5]undecan-1-one.
| Compound Name | formic acid;(6R,11S)-11-hydroxy-8-[4-(1,2,4-triazol-1-yl)butanoyl]-2,8-diazaspiro[5.5]undecan-1-one |
|---|---|
| PubChem CID | 166597986 |
| Molecular Formula | C16H25N5O5 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | formic acid;(6R,11S)-11-hydroxy-8-[4-(1,2,4-triazol-1-yl)butanoyl]-2,8-diazaspiro[5.5]undecan-1-one |
| SMILES | O=C(CCCn1cncn1)N1CC[C@H](O)[C@@]2(CCCNC2=O)C1.O=CO |
| InChI | InChI=1S/C15H23N5O3.CH2O2/c21-12-4-8-19(9-15(12)5-2-6-17-14(15)23)13(22)3-1-7-20-11-16-10-18-20;2-1-3/h10-12,21H,1-9H2,(H,17,23);1H,(H,2,3)/t12-,15+;/m0./s1 |
| InChIKey | ALQSAMGZVQABRP-SBKWZQTDSA-N |
| XLogP | -0.75 |
| TPSA | 137.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|