C24H37N3O4 — CID 124550709
(3S,4S)-N,1-dicyclohexyl-3-(cyclohexylamino)-2,5,6-trioxopiperidine-4-carboxamide (PubChem CID 124550709) has the molecular formula C24H37N3O4 and a molecular weight of 431.58 g/mol. Its IUPAC name is (3S,4S)-N,1-dicyclohexyl-3-(cyclohexylamino)-2,5,6-trioxopiperidine-4-carboxamide.
| Compound Name | (3S,4S)-N,1-dicyclohexyl-3-(cyclohexylamino)-2,5,6-trioxopiperidine-4-carboxamide |
|---|---|
| PubChem CID | 124550709 |
| Molecular Formula | C24H37N3O4 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.28 |
| IUPAC Name | (3S,4S)-N,1-dicyclohexyl-3-(cyclohexylamino)-2,5,6-trioxopiperidine-4-carboxamide |
| SMILES | O=C(NC1CCCCC1)[C@@H]1C(=O)C(=O)N(C2CCCCC2)C(=O)[C@H]1NC1CCCCC1 |
| InChI | InChI=1S/C24H37N3O4/c28-21-19(22(29)26-17-12-6-2-7-13-17)20(25-16-10-4-1-5-11-16)23(30)27(24(21)31)18-14-8-3-9-15-18/h16-20,25H,1-15H2,(H,26,29)/t19-,20-/m0/s1 |
| InChIKey | AJSNGWPXOSLKIO-PMACEKPBSA-N |
| XLogP | 2.61 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|