C17H26N4O3 — CID 98385369
(3S,4E)-N,1-dicyclohexyl-4-hydrazinylidene-2,5-dioxopyrrolidine-3-carboxamide (PubChem CID 98385369) has the molecular formula C17H26N4O3 and a molecular weight of 334.42 g/mol. Its IUPAC name is (3S,4E)-N,1-dicyclohexyl-4-hydrazinylidene-2,5-dioxopyrrolidine-3-carboxamide.
| Compound Name | (3S,4E)-N,1-dicyclohexyl-4-hydrazinylidene-2,5-dioxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 98385369 |
| Molecular Formula | C17H26N4O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | (3S,4E)-N,1-dicyclohexyl-4-hydrazinylidene-2,5-dioxopyrrolidine-3-carboxamide |
| SMILES | N/N=C1/C(=O)N(C2CCCCC2)C(=O)[C@@H]1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C17H26N4O3/c18-20-14-13(15(22)19-11-7-3-1-4-8-11)16(23)21(17(14)24)12-9-5-2-6-10-12/h11-13H,1-10,18H2,(H,19,22)/b20-14+/t13-/m0/s1 |
| InChIKey | RPBSNEWYZGLSRS-XXACCHKKSA-N |
| XLogP | 1.07 |
| TPSA | 104.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|