C23H32N4O2 — CID 7921970
(3R,4E)-N,1-dicyclohexyl-5-oxo-4-(phenylhydrazinylidene)pyrrolidine-3-carboxamide (PubChem CID 7921970) has the molecular formula C23H32N4O2 and a molecular weight of 396.54 g/mol. Its IUPAC name is (3R,4E)-N,1-dicyclohexyl-5-oxo-4-(phenylhydrazinylidene)pyrrolidine-3-carboxamide.
| Compound Name | (3R,4E)-N,1-dicyclohexyl-5-oxo-4-(phenylhydrazinylidene)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 7921970 |
| Molecular Formula | C23H32N4O2 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | (3R,4E)-N,1-dicyclohexyl-5-oxo-4-(phenylhydrazinylidene)pyrrolidine-3-carboxamide |
| SMILES | O=C(NC1CCCCC1)[C@@H]1CN(C2CCCCC2)C(=O)/C1=N/Nc1ccccc1 |
| InChI | InChI=1S/C23H32N4O2/c28-22(24-17-10-4-1-5-11-17)20-16-27(19-14-8-3-9-15-19)23(29)21(20)26-25-18-12-6-2-7-13-18/h2,6-7,12-13,17,19-20,25H,1,3-5,8-11,14-16H2,(H,24,28)/b26-21+/t20-/m1/s1 |
| InChIKey | XBZOTNCMXCGNJC-KZLURRSOSA-N |
| XLogP | 3.69 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|