C14H17NO2 — CID 41068708
(3R)-2-cyclohexyl-3-hydroxy-3H-isoindol-1-one (PubChem CID 41068708) has the molecular formula C14H17NO2 and a molecular weight of 231.30 g/mol. Its IUPAC name is (3R)-2-cyclohexyl-3-hydroxy-3H-isoindol-1-one.
| Compound Name | (3R)-2-cyclohexyl-3-hydroxy-3H-isoindol-1-one |
|---|---|
| PubChem CID | 41068708 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | (3R)-2-cyclohexyl-3-hydroxy-3H-isoindol-1-one |
| SMILES | O=C1c2ccccc2[C@@H](O)N1C1CCCCC1 |
| InChI | InChI=1S/C14H17NO2/c16-13-11-8-4-5-9-12(11)14(17)15(13)10-6-2-1-3-7-10/h4-5,8-10,13,16H,1-3,6-7H2/t13-/m1/s1 |
| InChIKey | QFJYVOQFFWBMQB-CYBMUJFWSA-N |
| XLogP | 2.47 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |