C13H11NO5 — CID 153133719
3-(1-hydroxy-3-oxo-1H-isoindol-2-yl)oxane-2,6-dione (PubChem CID 153133719) has the molecular formula C13H11NO5 and a molecular weight of 261.23 g/mol. Its IUPAC name is 3-(1-hydroxy-3-oxo-1H-isoindol-2-yl)oxane-2,6-dione.
| Compound Name | 3-(1-hydroxy-3-oxo-1H-isoindol-2-yl)oxane-2,6-dione |
|---|---|
| PubChem CID | 153133719 |
| Molecular Formula | C13H11NO5 |
| Molecular Weight | 261.23 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 3-(1-hydroxy-3-oxo-1H-isoindol-2-yl)oxane-2,6-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccccc3C2O)C(=O)O1 |
| InChI | InChI=1S/C13H11NO5/c15-10-6-5-9(13(18)19-10)14-11(16)7-3-1-2-4-8(7)12(14)17/h1-4,9,11,16H,5-6H2 |
| InChIKey | VXFZAIGNCZLCAQ-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.23 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|