C14H9NO7 — CID 124537439
2-[(3S)-2,6-dioxooxan-3-yl]-1,3-dioxoisoindole-5-carboxylic acid (PubChem CID 124537439) has the molecular formula C14H9NO7 and a molecular weight of 303.23 g/mol. Its IUPAC name is 2-[(3S)-2,6-dioxooxan-3-yl]-1,3-dioxoisoindole-5-carboxylic acid.
| Compound Name | 2-[(3S)-2,6-dioxooxan-3-yl]-1,3-dioxoisoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 124537439 |
| Molecular Formula | C14H9NO7 |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 2-[(3S)-2,6-dioxooxan-3-yl]-1,3-dioxoisoindole-5-carboxylic acid |
| SMILES | O=C1CC[C@H](N2C(=O)c3ccc(C(=O)O)cc3C2=O)C(=O)O1 |
| InChI | InChI=1S/C14H9NO7/c16-10-4-3-9(14(21)22-10)15-11(17)7-2-1-6(13(19)20)5-8(7)12(15)18/h1-2,5,9H,3-4H2,(H,19,20)/t9-/m0/s1 |
| InChIKey | PBXCCYLWUUIAMA-VIFPVBQESA-N |
| XLogP | 0.21 |
| TPSA | 118.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|