C13H7N3O4 — CID 43616140
1,3-dioxo-2-pyrazin-2-ylisoindole-5-carboxylic acid (PubChem CID 43616140) has the molecular formula C13H7N3O4 and a molecular weight of 269.22 g/mol. Its IUPAC name is 1,3-dioxo-2-pyrazin-2-ylisoindole-5-carboxylic acid.
| Compound Name | 1,3-dioxo-2-pyrazin-2-ylisoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 43616140 |
| Molecular Formula | C13H7N3O4 |
| Molecular Weight | 269.22 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | 1,3-dioxo-2-pyrazin-2-ylisoindole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)C(=O)N(c1cnccn1)C2=O |
| InChI | InChI=1S/C13H7N3O4/c17-11-8-2-1-7(13(19)20)5-9(8)12(18)16(11)10-6-14-3-4-15-10/h1-6H,(H,19,20) |
| InChIKey | KOTQCKXMUDBBOP-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 100.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.22 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|