3,4-dipyridin-3-ylbenzoic acid

C17H12N2O2 — CID 46316417

IUPAC3,4-dipyridin-3-ylbenzoic acid
SMILESO=C(O)c1ccc(-c2cccnc2)c(-c2cccnc2)c1
InChIInChI=1S/C17H12N2O2/c20-17(21)12-5-6-15(13-3-1-7-18-10-13)16(9-12)14-4-2-8-19-11-14/h1-11H,(H,20,21)
InChIKeyOSXXGNQCGSVBBD-UHFFFAOYSA-N
MW276.30 g/mol
LogP3.51
Rot. Bonds3

About 3,4-dipyridin-3-ylbenzoic acid

3,4-dipyridin-3-ylbenzoic acid (PubChem CID 46316417) has the molecular formula C17H12N2O2 and a molecular weight of 276.30 g/mol. Its IUPAC name is 3,4-dipyridin-3-ylbenzoic acid.

Molecular Properties

Compound Name3,4-dipyridin-3-ylbenzoic acid
PubChem CID46316417
Molecular FormulaC17H12N2O2
Molecular Weight276.30 g/mol
Exact Mass276.09
IUPAC Name3,4-dipyridin-3-ylbenzoic acid
SMILESO=C(O)c1ccc(-c2cccnc2)c(-c2cccnc2)c1
InChIInChI=1S/C17H12N2O2/c20-17(21)12-5-6-15(13-3-1-7-18-10-13)16(9-12)14-4-2-8-19-11-14/h1-11H,(H,20,21)
InChIKeyOSXXGNQCGSVBBD-UHFFFAOYSA-N
XLogP3.51
TPSA63.08 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500276.30
LogP ≤ 53.51
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3,4-dipyridin-3-ylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,4-dipyridin-3-ylbenzoic acid?
The IUPAC name of 3,4-dipyridin-3-ylbenzoic acid (CID 46316417) is 3,4-dipyridin-3-ylbenzoic acid.
What is the SMILES notation for 3,4-dipyridin-3-ylbenzoic acid?
The canonical SMILES for 3,4-dipyridin-3-ylbenzoic acid is O=C(O)c1ccc(-c2cccnc2)c(-c2cccnc2)c1.
What is the InChIKey of 3,4-dipyridin-3-ylbenzoic acid?
The InChIKey is OSXXGNQCGSVBBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12N2O2/c20-17(21)12-5-6-15(13-3-1-7-18-10-13)16(9-12)14-4-2-8-19-11-14/h1-11H,(H,20,21).
What are the key properties of 3,4-dipyridin-3-ylbenzoic acid?
3,4-dipyridin-3-ylbenzoic acid has a molecular weight of 276.30 g/mol, XLogP of 3.51, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dipyridin-3-ylbenzoic acid is sourced from PubChem (CID 46316417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).