C20H14N2O5 — CID 146021058
5-[(4-pyridin-3-ylbenzoyl)amino]benzene-1,3-dicarboxylic acid (PubChem CID 146021058) has the molecular formula C20H14N2O5 and a molecular weight of 362.34 g/mol. Its IUPAC name is 5-[(4-pyridin-3-ylbenzoyl)amino]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[(4-pyridin-3-ylbenzoyl)amino]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 146021058 |
| Molecular Formula | C20H14N2O5 |
| Molecular Weight | 362.34 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | 5-[(4-pyridin-3-ylbenzoyl)amino]benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(NC(=O)c2ccc(-c3cccnc3)cc2)cc(C(=O)O)c1 |
| InChI | InChI=1S/C20H14N2O5/c23-18(13-5-3-12(4-6-13)14-2-1-7-21-11-14)22-17-9-15(19(24)25)8-16(10-17)20(26)27/h1-11H,(H,22,23)(H,24,25)(H,26,27) |
| InChIKey | QECRFTGKKVHSKO-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 116.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.34 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |