C9H14ClNO — CID 13466918
(5R,8aR)-7-chloro-5-methyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one (PubChem CID 13466918) has the molecular formula C9H14ClNO and a molecular weight of 187.67 g/mol. Its IUPAC name is (5R,8aR)-7-chloro-5-methyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one.
| Compound Name | (5R,8aR)-7-chloro-5-methyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
|---|---|
| PubChem CID | 13466918 |
| Molecular Formula | C9H14ClNO |
| Molecular Weight | 187.67 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | (5R,8aR)-7-chloro-5-methyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
| SMILES | C[C@@H]1CC(Cl)C[C@H]2CCC(=O)N21 |
| InChI | InChI=1S/C9H14ClNO/c1-6-4-7(10)5-8-2-3-9(12)11(6)8/h6-8H,2-5H2,1H3/t6-,7?,8-/m1/s1 |
| InChIKey | YNPLYVDUMYOKBK-OECOWPMFSA-N |
| XLogP | 1.77 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.67 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|