C8H14ClN — CID 98059828
(1R,5R)-3-chloro-8-methyl-8-azabicyclo[3.2.1]octane (PubChem CID 98059828) has the molecular formula C8H14ClN and a molecular weight of 159.66 g/mol. Its IUPAC name is (1R,5R)-3-chloro-8-methyl-8-azabicyclo[3.2.1]octane.
| Compound Name | (1R,5R)-3-chloro-8-methyl-8-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 98059828 |
| Molecular Formula | C8H14ClN |
| Molecular Weight | 159.66 g/mol |
| Exact Mass | 159.08 |
| IUPAC Name | (1R,5R)-3-chloro-8-methyl-8-azabicyclo[3.2.1]octane |
| SMILES | CN1[C@@H]2CC[C@@H]1CC(Cl)C2 |
| InChI | InChI=1S/C8H14ClN/c1-10-7-2-3-8(10)5-6(9)4-7/h6-8H,2-5H2,1H3/t7-,8-/m1/s1 |
| InChIKey | WXRBWXUZUHYHQS-HTQZYQBOSA-N |
| XLogP | 1.85 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.66 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|