C7H12ClN — CID 131218994
(1R,2S,4S)-2-chloro-7-methyl-7-azabicyclo[2.2.1]heptane (PubChem CID 131218994) has the molecular formula C7H12ClN and a molecular weight of 145.63 g/mol. Its IUPAC name is (1R,2S,4S)-2-chloro-7-methyl-7-azabicyclo[2.2.1]heptane.
| Compound Name | (1R,2S,4S)-2-chloro-7-methyl-7-azabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 131218994 |
| Molecular Formula | C7H12ClN |
| Molecular Weight | 145.63 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | (1R,2S,4S)-2-chloro-7-methyl-7-azabicyclo[2.2.1]heptane |
| SMILES | CN1[C@H]2CC[C@@H]1[C@@H](Cl)C2 |
| InChI | InChI=1S/C7H12ClN/c1-9-5-2-3-7(9)6(8)4-5/h5-7H,2-4H2,1H3/t5-,6-,7+/m0/s1 |
| InChIKey | HZIKTTSBMIBXLL-LYFYHCNISA-N |
| XLogP | 1.46 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.63 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|