C8H14N2 — CID 154939031
[(1R,2R,4S)-7-methyl-7-azabicyclo[2.2.1]heptan-2-yl]methanimine (PubChem CID 154939031) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is [(1R,2R,4S)-7-methyl-7-azabicyclo[2.2.1]heptan-2-yl]methanimine.
| Compound Name | [(1R,2R,4S)-7-methyl-7-azabicyclo[2.2.1]heptan-2-yl]methanimine |
|---|---|
| PubChem CID | 154939031 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | [(1R,2R,4S)-7-methyl-7-azabicyclo[2.2.1]heptan-2-yl]methanimine |
| SMILES | [H]/N=C/[C@@H]1C[C@@H]2CC[C@H]1N2C |
| InChI | InChI=1S/C8H14N2/c1-10-7-2-3-8(10)6(4-7)5-9/h5-9H,2-4H2,1H3/b9-5+/t6-,7-,8+/m0/s1 |
| InChIKey | NCLSGUPGCKMHLB-OZTQDWKNSA-N |
| XLogP | 1.12 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|