C11H21NS — CID 146618098
1-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]propane-2-thiol (PubChem CID 146618098) has the molecular formula C11H21NS and a molecular weight of 199.36 g/mol. Its IUPAC name is 1-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]propane-2-thiol.
| Compound Name | 1-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]propane-2-thiol |
|---|---|
| PubChem CID | 146618098 |
| Molecular Formula | C11H21NS |
| Molecular Weight | 199.36 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | 1-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]propane-2-thiol |
| SMILES | CC(S)CC1C[C@H]2CC[C@@H](C1)N2C |
| InChI | InChI=1S/C11H21NS/c1-8(13)5-9-6-10-3-4-11(7-9)12(10)2/h8-11,13H,3-7H2,1-2H3/t8?,9?,10-,11+ |
| InChIKey | QQKGXSGGHXPKFN-HWACXVBKSA-N |
| XLogP | 2.57 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|