C8H16N2 — CID 124527057
(1R,2R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-2-amine (PubChem CID 124527057) has the molecular formula C8H16N2 and a molecular weight of 140.23 g/mol. Its IUPAC name is (1R,2R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-2-amine.
| Compound Name | (1R,2R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-2-amine |
|---|---|
| PubChem CID | 124527057 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | (1R,2R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-2-amine |
| SMILES | CN1[C@H]2CC[C@@H](N)[C@H]1CC2 |
| InChI | InChI=1S/C8H16N2/c1-10-6-2-4-7(9)8(10)5-3-6/h6-8H,2-5,9H2,1H3/t6-,7+,8+/m0/s1 |
| InChIKey | DVWWFIRHFFEWAP-XLPZGREQSA-N |
| XLogP | 0.57 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |