About methane;7-methyl-7-azabicyclo[2.2.1]heptane;8-methyl-8-azabicyclo[3.2.1]octane
methane;7-methyl-7-azabicyclo[2.2.1]heptane;8-methyl-8-azabicyclo[3.2.1]octane (PubChem CID 157389417) has the molecular formula C18H40N2
and a molecular weight of 284.53 g/mol. Its IUPAC name is methane;7-methyl-7-azabicyclo[2.2.1]heptane;8-methyl-8-azabicyclo[3.2.1]octane.
Molecular Properties
| Compound Name | methane;7-methyl-7-azabicyclo[2.2.1]heptane;8-methyl-8-azabicyclo[3.2.1]octane |
| PubChem CID | 157389417 |
| Molecular Formula | C18H40N2 |
| Molecular Weight | 284.53 g/mol |
| Exact Mass | 284.32 |
| IUPAC Name | methane;7-methyl-7-azabicyclo[2.2.1]heptane;8-methyl-8-azabicyclo[3.2.1]octane |
| SMILES | C.C.C.CN1C2CCC1CC2.CN1C2CCCC1CC2 |
| InChI | InChI=1S/C8H15N.C7H13N.3CH4/c1-9-7-3-2-4-8(9)6-5-7;1-8-6-2-3-7(8)5-4-6;;;/h7-8H,2-6H2,1H3;6-7H,2-5H2,1H3;3*1H4 |
| InChIKey | BLVAKKLURIQETG-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.53 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methane;7-methyl-7-azabicyclo[2.2.1]heptane;8-methyl-8-azabicyclo[3.2.1]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;7-methyl-7-azabicyclo[2.2.1]heptane;8-methyl-8-azabicyclo[3.2.1]octane?
The IUPAC name of methane;7-methyl-7-azabicyclo[2.2.1]heptane;8-methyl-8-azabicyclo[3.2.1]octane (CID 157389417) is methane;7-methyl-7-azabicyclo[2.2.1]heptane;8-methyl-8-azabicyclo[3.2.1]octane.
What is the SMILES notation for methane;7-methyl-7-azabicyclo[2.2.1]heptane;8-methyl-8-azabicyclo[3.2.1]octane?
The canonical SMILES for methane;7-methyl-7-azabicyclo[2.2.1]heptane;8-methyl-8-azabicyclo[3.2.1]octane is C.C.C.CN1C2CCC1CC2.CN1C2CCCC1CC2.
What is the InChIKey of methane;7-methyl-7-azabicyclo[2.2.1]heptane;8-methyl-8-azabicyclo[3.2.1]octane?
The InChIKey is BLVAKKLURIQETG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N.C7H13N.3CH4/c1-9-7-3-2-4-8(9)6-5-7;1-8-6-2-3-7(8)5-4-6;;;/h7-8H,2-6H2,1H3;6-7H,2-5H2,1H3;3*1H4.
What are the key properties of methane;7-methyl-7-azabicyclo[2.2.1]heptane;8-methyl-8-azabicyclo[3.2.1]octane?
methane;7-methyl-7-azabicyclo[2.2.1]heptane;8-methyl-8-azabicyclo[3.2.1]octane has a molecular weight of 284.53 g/mol, XLogP of 4.78, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;7-methyl-7-azabicyclo[2.2.1]heptane;8-methyl-8-azabicyclo[3.2.1]octane is sourced from PubChem (CID 157389417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).