About 6-methyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one
6-methyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one (PubChem CID 131876212) has the molecular formula C9H15NO
and a molecular weight of 153.22 g/mol. Its IUPAC name is 6-methyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one.
Analyze 6-methyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one?
The IUPAC name of 6-methyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one (CID 131876212) is 6-methyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one.
What is the SMILES notation for 6-methyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one?
The canonical SMILES for 6-methyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one is CC1CCC2CCC(=O)N2C1.
What is the InChIKey of 6-methyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one?
The InChIKey is SUUGLDWHMGGUEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO/c1-7-2-3-8-4-5-9(11)10(8)6-7/h7-8H,2-6H2,1H3.
What are the key properties of 6-methyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one?
6-methyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one has a molecular weight of 153.22 g/mol, XLogP of 1.41, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one is sourced from PubChem (CID 131876212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).