About (6S)-6-fluoro-1,2,5,6,7,8-hexahydropyrrolizin-3-one
(6S)-6-fluoro-1,2,5,6,7,8-hexahydropyrrolizin-3-one (PubChem CID 167250307) has the molecular formula C7H10FNO
and a molecular weight of 143.16 g/mol. Its IUPAC name is (6S)-6-fluoro-1,2,5,6,7,8-hexahydropyrrolizin-3-one.
Analyze (6S)-6-fluoro-1,2,5,6,7,8-hexahydropyrrolizin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-6-fluoro-1,2,5,6,7,8-hexahydropyrrolizin-3-one?
The IUPAC name of (6S)-6-fluoro-1,2,5,6,7,8-hexahydropyrrolizin-3-one (CID 167250307) is (6S)-6-fluoro-1,2,5,6,7,8-hexahydropyrrolizin-3-one.
What is the SMILES notation for (6S)-6-fluoro-1,2,5,6,7,8-hexahydropyrrolizin-3-one?
The canonical SMILES for (6S)-6-fluoro-1,2,5,6,7,8-hexahydropyrrolizin-3-one is O=C1CCC2C[C@H](F)CN12.
What is the InChIKey of (6S)-6-fluoro-1,2,5,6,7,8-hexahydropyrrolizin-3-one?
The InChIKey is UDQLKFARJFMGMO-ZBHICJROSA-N. The full InChI is InChI=1S/C7H10FNO/c8-5-3-6-1-2-7(10)9(6)4-5/h5-6H,1-4H2/t5-,6?/m0/s1.
What are the key properties of (6S)-6-fluoro-1,2,5,6,7,8-hexahydropyrrolizin-3-one?
(6S)-6-fluoro-1,2,5,6,7,8-hexahydropyrrolizin-3-one has a molecular weight of 143.16 g/mol, XLogP of 0.72, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-6-fluoro-1,2,5,6,7,8-hexahydropyrrolizin-3-one is sourced from PubChem (CID 167250307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).