C14H24N2O — CID 143591945
(3aR)-1-(azepan-4-yl)-3a,4,5,6,7,7a-hexahydro-3H-indol-2-one (PubChem CID 143591945) has the molecular formula C14H24N2O and a molecular weight of 236.36 g/mol. Its IUPAC name is (3aR)-1-(azepan-4-yl)-3a,4,5,6,7,7a-hexahydro-3H-indol-2-one.
| Compound Name | (3aR)-1-(azepan-4-yl)-3a,4,5,6,7,7a-hexahydro-3H-indol-2-one |
|---|---|
| PubChem CID | 143591945 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | (3aR)-1-(azepan-4-yl)-3a,4,5,6,7,7a-hexahydro-3H-indol-2-one |
| SMILES | O=C1C[C@H]2CCCCC2N1C1CCCNCC1 |
| InChI | InChI=1S/C14H24N2O/c17-14-10-11-4-1-2-6-13(11)16(14)12-5-3-8-15-9-7-12/h11-13,15H,1-10H2/t11-,12?,13?/m1/s1 |
| InChIKey | AJACBKQUJIRTPC-PNESKVBLSA-N |
| XLogP | 1.92 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |